| A | B | C | D | E | F | G | H | I | J | K | L | M | N | O | P | Q | R | S | T | U | V | W | X | Y | Z | AA | AB | AC | AD | AE | AF | AG | AH | ||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
1 | Огляд цитувань Ужгородського національного університету в наукометричний базі Scopus | ||||||||||||||||||||||||||||||||||
2 | Uzhhorod National University | ||||||||||||||||||||||||||||||||||
3 | Оновлено 21.12.2022 р. | ||||||||||||||||||||||||||||||||||
4 | Загальна кількість публікацій – 3286 h-индекс = 46 Кількість цитувань – 18395 | ||||||||||||||||||||||||||||||||||
5 | 2019 | 2020 | 2021 | 2022 | проміжний підсумок | >2022 | всього | ||||||||||||||||||||||||||||
6 | Рік публікації | Назва публікації | Автори публікації | ISSN журналу | Назва журналу / видання | Том | Випуск | 1458 | 1855 | 2216 | 1989 | 10497 | 47 | 18395 | |||||||||||||||||||||
7 | |||||||||||||||||||||||||||||||||||
8 | 2023 | Antibacterial Application of Carpathian Clinoptilolite as Cetylpyridinium Carrier | Milyovich S., Pantyo V., Danko E., Pogodin A., Filep M., Fizer O., Fizer M., Sidey V., Mariychuk R. | 20695837 | Biointerface Research in Applied Chemistry | 13 | 4 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
9 | 2023 | Formation of Subsets of Co-expressed Gene Expression Profiles Based on Joint Use of Fuzzy Inference System, Statistical Criteria and Shannon Entropy | Liakh I., Babichev S., Durnyak B., Gado I. | 23674512 | Lecture Notes on Data Engineering and Communications Technologies | 149 | 0 | 0 | 0 | 1 | 1 | 0 | 1 | ||||||||||||||||||||||
10 | 2023 | Global attractors of mild solutions semiflow for semilinear parabolic equation without uniqueness | Feketa P., Kapustyan O.V., Kapustian O.A., Korol I.I. | 8939659 | Applied Mathematics Letters | 135 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
11 | 2022 | On the structure of cetylpyridinium perchlorate: A combined XRD, NMR, IR and DFT study | Fizer O., Fizer M., Filep M., Sidey V., Mariychuk R. | 1677322 | Journal of Molecular Liquids | 368 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
12 | 2022 | Influence of crystal structure disordering on ionic conductivity of Ag7+x(P1−xGex)S6 single crystals | Pogodin A.I., Filep M.J., Studenyak V.I., Symkanych O.I., Stercho I.P., Izai V.Y., Kokhan O.P., Kus P. | 9258388 | Journal of Alloys and Compounds | 926 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
13 | 2022 | Leptospirosis: Prognostic Model for Patient Mortality in the Transcarpathian Region, Ukraine | Petakh P., Isevych V., Mohammed I.B., Nykyforuk A., Rostoka L. | 15577759 | Vector borne and zoonotic diseases (Larchmont, N.Y.) | 22 | 12 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
14 | 2022 | Microstructural, mechanical and electrical properties of superionic Ag6+x(P1-xGex)S5I ceramic materials | Pogodin A.I., Filep M.J., Malakhovska T.O., Vakulchak V.V., Komanicky V., Izai V.Y., Studenyak Y.I., Zhukova Y.P., Shender I.O., Bilanych V.S., Kokhan O.P., Kus P. | 223697 | Journal of Physics and Chemistry of Solids | 171 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
15 | 2022 | Laser cleaning and Raman analysis of the contamination on the optical window of a rubidium vapor cell | Gadoros P., Czitrovszky A., Nagy A., Holomb R., Kocsanyi L., Veres M. | 20452322 | Scientific Reports | 12 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
16 | 2022 | On the effective ionic radii for the tin(II) cation | Sidey V. | 223697 | Journal of Physics and Chemistry of Solids | 171 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
17 | 2022 | Validation of a modified questionnaire to assess Ukrainian Family Physicians’ readiness to implement the evidence-based screening recommendations into their clinical practice, using a mixed method study | Shushman I., Kolesnyk A., Kolesnyk P., Kuodza G., Mykyta I., Bayen S., Frese T. | 27314553 | BMC Primary Care | 23 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
18 | 2022 | Endocrine manifestations of chronic kidney disease and their evolving management: A systematic review | Kaka N., Sethi Y., Patel N., Kaiwan O., Al-Inaya Y., Manchanda K., Uniyal N. | 115029 | Disease-a-Month | 68 | 12 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
19 | 2022 | Genetic diversity and selection in Puerto Rican horses | Wolfsberger W.W., Ayala N.M., Castro-Marquez S.O., Irizarry-Negron V.M., Potapchuk A., Shchubelka K., Potish L., Majeske A.J., Oliver L.F., Lameiro A.D., Martinez-Cruzado J.C., Lindgren G., Oleksyk T.K. | 20452322 | Scientific Reports | 12 | 1 | 0 | 0 | 0 | 1 | 1 | 0 | 1 | |||||||||||||||||||||
20 | 2022 | Proactive psychological and psychiatric support of patients with chronic non-communicable diseases in a randomised trial: a Ukrainian experience | Khaustova O.O., Markova M.V., Driuchenko M.O., Burdeinyi A.O. | 2517729X | General Psychiatry | 35 | 5 | 0 | 0 | 0 | 1 | 1 | 0 | 1 | |||||||||||||||||||||
21 | 2022 | Transformation of Threats to Demographic Security and Sustainable Development of the Region Due to Increased Military Actions | Andriyiv N., Pushak H., Petrukha N., Kokhan V., Shtangret I. | 17437601 | International Journal of Sustainable Development and Planning | 17 | 7 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
22 | 2022 | Hybrid Inductive Model of Differentially and Co-Expressed Gene Expression Profile Extraction Based on the Joint Use of Clustering Technique and Convolutional Neural Network | Babichev S., Yasinska-Damri L., Liakh I., Skvor J. | 20763417 | Applied Sciences (Switzerland) | 12 | 22 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
23 | 2022 | Gut microbiota status in leptospirosis: An unrecognized player? | Petakh P., Isevych V. | 20522975 | New Microbes and New Infections | 49-50 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
24 | 2022 | Annulated carbamates are precursors for the ring contraction of the adamantane framework | Hrdina R., Holovko-Kamoshenkova O.M., Cisarova I., Koucky F., Machalicky O. | 20462069 | RSC Advances | 12 | 48 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
25 | 2022 | The effectiveness of using power fitness training loads to increase adaptive reserves of female athletes in hand-to-hand combat | Manolachi V., Chernozub A., Potop V., Marionda I., Titova H., Sherstiuk L., Shtefiuk I. | 26649837 | Pedagogy of Physical Culture and Sports | 26 | 5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
26 | 2022 | Spectroscopic Parameters of the Exotic Helium Atom within the Hyperspheric Adiabatic Approach in One-Dimensional Space | Haysak M.I., Haysak I.I., Nagy M., Onysko V.V. | 5874246 | Acta Physica Polonica A | 142 | 4 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
27 | 2022 | Digital Aspects of the Ukrainian Digitalization | Tokar M., Shybirina S., Kolosovska I., Khmarska I. | 4242513 | Economic Affairs (New Delhi) | 67 | 4 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
28 | 2022 | State Regulation of Tourism Development and Competition in the Tourism Industry: EU Experience for Ukraine | Sira E., Prokopenko T., Zatsepina N., Domyshche-Medyanyk A., Kryvenkova R. | 4242513 | Economic Affairs (New Delhi) | 67 | 4 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
29 | 2022 | Characteristics and Parameters of Plasma of a High-Voltage Nanosecond Discharge in Argon at Atmospheric Pressure with an Ectonic Mechanism of Copper Vapor Introduction into Plasma | Shuaibov O.K., Minya O.Y., Malinina A.O., Malinin O.M., Hrytsak R.V., Gomoki Z.T., Vatrala M.I. | 10683755 | Surface Engineering and Applied Electrochemistry | 58 | 5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
30 | 2022 | Influence of co-doping of divalent ions on the photoluminescence intensity of Mn4+ doped CaAl12O19 | Zafari U., Sagayama M., Subhoni M., Srivastava A.M., Beers W.W., Cohen W.E., Ma C.-G., Piasecki M., Brik M.G., Yamamoto T. | 25901478 | Optical Materials: X | 16 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
31 | 2022 | First-principles computation of the electronic structure and optical properties of Tl3PbBr5 and TlPb2Br5: Application of the TB-mBJ+U+SOC technique | Khyzhun O.Y., Vu T.V., Gabrelian B.V., Lavrentyev A.A., Kalmykova K.F., Ananchenko L.N., Denysyuk N.M., Bragiel P., Piasecki M. | 9253467 | Optical Materials | 132 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
32 | 2022 | Attractivity of various artificial light sources to caddisfly (Trichoptera) species and its importance in their sampling and conservation | Szanyi K., Nagy A., Varga Z., Potish L., Szanyi S. | 1366638X | Journal of Insect Conservation | 26 | 5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
33 | 2022 | EPR, optical and thermometric studies of Cr3+ ions in the α-Al2O3 synthetic single crystal | Mironova - Ulmane N., Brik M.G., Grube J., Krieke G., M.Kemere, Antuzevics A., Gabrusenoks E., Skvortsova V., Elsts E., Sarakovskis A., Piasecki M., Popov A.I. | 9253467 | Optical Materials | 132 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | ||||||||||||||||||||||
34 | 2022 | Investigation of the chemical and radiation stability of titanium dioxide with surface arsenate groups during 90Sr adsorption | Mironyuk I., Kaglyan A., Vasylyeva H., Mykytyn I., Gudkov D., Turovska L. | 0265931X | Journal of Environmental Radioactivity | 251-252 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
35 | 2022 | Synthesis and Optical Properties of Ag–Ga–S Quantum Dots | Azhniuk Y., Lopushanska B., Selyshchev O., Havryliuk Y., Pogodin A., Kokhan O., Ehm A., Lopushansky V., Studenyak I., Zahn D.R.T. | 3701972 | Physica Status Solidi (B) Basic Research | 259 | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
36 | 2022 | Ag3AsS3-As2S3 composite: Detailed impedance spectroscopy study | Kavaliuke V., Salkus T., Kezionis A., Pop M.M., Studenyak I.P. | 1672738 | Solid State Ionics | 383 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
37 | 2022 | [Structural and morphological properties of titanium dioxide nanoparticles doped by Boron atoms, Структурно-морфологічні властивості наночастинкового діоксиду титану допованого атомами Бору] | Mironyuk I., Mykytyn I., Vasylyeva H. | 17294428 | Physics and Chemistry of Solid State | 23 | 3 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
38 | 2022 | MODELS AND ALGORITHMS FOR OPTIMIZING THE RESERVE OF EQUIPMENT TO ENSURE THE CYBERSECURITY OF THE INFORMATION EDUCATIONAL ENVIRONMENT OF THE UNIVERSITY | AKHMETOV B.S., ABUOVA A.K., IZBASOVA N.B., ZHILKISHBAYEV A.A., GERASYMCHUK N., MATOVKA T., RIZAK V. | 19928645 | Journal of Theoretical and Applied Information Technology | 100 | 18 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
39 | 2022 | The Pioneer Advantage: Filling the blank spots on the map of genome diversity in Europe | Oleksyk T.K., Wolfsberger W.W., Schubelka K., Mangul S., O'Brien S.J. | 2047217X | GigaScience | 11 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
40 | 2022 | PARTICIPATION OF TRAUMATOLOGISTS IN PROVIDING MEDICAL REHABILITATION OF PATIENTS WITH INJURIES AT THE REGIONAL LEVEL | Brych V., Vasylynets M., Shmanko O., Bilak-Lukyanchuk V. | 15120112 | Georgian medical news | 330 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
41 | 2022 | The Conceptual Framework for Creating an Industrial Smart and Tourism Favoured Cluster for Sustainable Development of the Ukranian Region | Danylyshyn B., Kovalova O., Oleshko A., Morhulets O., Zayats M., Yaremko S. | 4242513 | Economic Affairs (New Delhi) | 67 | 4 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
42 | 2022 | Determinants of Housing Construction in Ukraine | Bochko O., Kosar N., Kuzo N., Bilyk I., Zarichna O. | 23005289 | Real Estate Management and Valuation | 30 | 3 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
43 | 2022 | Effect of structural site disorder on the optical properties of Ag6+x(P1−xGex)S5I solid solutions | Pogodin A.I., Pop M.M., Shender I.O., Studenyak I.P., Filep M.J., Malakhovska T.O., Kokhan O.P., Babuka T.Y., Stercho I.P., Rubish V.M., Kopcansky P. | 9574522 | Journal of Materials Science: Materials in Electronics | 33 | 27 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
44 | 2022 | Synthesis and Antimicrobial Activity of Functional Derivatives of thiazolo[2,3-c][1,2,4]triazoles | Slivka M., Fizer M., Mariychuk R., Ostafin M., Moyzesh O., Koval' G.-Y., Holovko-Kamoshenkova O., Rusyn I., Lendel V. | 15701808 | Letters in Drug Design and Discovery | 19 | 9 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
45 | 2022 | Genetic overlap between dystonia and other neurologic disorders: A study of 1,100 exomes | Dzinovic I., Boesch S., Skorvanek M., Necpal J., Svantnerova J., Pavelekova P., Havrankova P., Tsoma E., Indelicato E., Runkel E., Held V., Weise D., Janzarik W., Eckenweiler M., Berweck S., Mall V., Haslinger B., Jech R., Winkelmann J., Zech M. | 13538020 | Parkinsonism and Related Disorders | 102 | 0 | 0 | 0 | 2 | 2 | 0 | 2 | ||||||||||||||||||||||
46 | 2022 | Electronic Structure, Optical, and Elastic Properties of AgGaS2 Crystal: Theoretical Study | Rudysh M.Y., Ftomyn N.Y., Shchepanskyi P.A., Myronchuk G.L., Popov A.I., Lemee N., Stadnyk V.Y., Brik M.G., Piasecki M. | 25130390 | Advanced Theory and Simulations | 5 | 9 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
47 | 2022 | Crystal growth and electrical conductivity of Ag7PS6 and Ag8GeS6 argyrodites | Pogodin A.I., Filep M.J., Izai V.Y., Kokhan O.P., Kus P. | 223697 | Journal of Physics and Chemistry of Solids | 168 | 0 | 0 | 0 | 2 | 2 | 0 | 2 | ||||||||||||||||||||||
48 | 2022 | DEVELOPMENT OF METHODS FOR THE STUDY OF DICYCLOMINE HYDROCHLORIDE IN COMBINATION WITH PARACETAMOL AS AN OBJECT OF FORENSIC-PHARMACEUTICAL EXAMINATION | Bevz O., Sych I., Fedosov A., Vislous O., Sych I., Kryvanych O., Kobzar N., Perekhoda L. | 25194844 | ScienceRise: Pharmaceutical Science | 2022 | 4 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
49 | 2022 | Psychologic interventions in patients with the chronic dermatologic itch in atopic dermatitis and psoriasis: A step forward with family constellations seminars | Capec S., Petrek M., Capec G., Yaremkevych R., Andrashko Y. | 2296858X | Frontiers in Medicine | 9 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
50 | 2022 | Physical properties of the trans-Neptunian object (38628) Huya from a multi-chord stellar occultation | Santos-Sanz P., Ortiz J.L., Sicardy B., Popescu M., Benedetti-Rossi G., Morales N., Vara-Lubiano M., Camargo J.I.B., Pereira C.L., Rommel F.L., Assafin M., Desmars J., Braga-Ribas F., Duffard R., Marques Oliveira J., Vieira-Martins R., Fernandez-Valenzuela E., Morgado B.E., Acar M., Anghel S., Atalay E., Ates A., Bakis H., Bakis V., Eker Z., Erece O., Kaspi S., Kayhan C., Kilic S.E., Kilic Y., Manulis I., Nedelcu D.A., Niaei M.S., Nir G., Ofek E., Ozisik T., Petrescu E., Satir O., Solmaz A., Sonka A., Tekes M., Unsalan O., Yesilyaprak C., Anghel R., Bertesteanu D., Curelaru L., Danescu C., Dumitrescu V., Gherase R., Hudin L., Stoian A.-M., Tercu J.O., Truta R., Turcu V., Vantdevara C., Belskaya I., Dementiev T.O., Gazeas K., Karampotsiou S., Kashuba V., Kiss Cs., Koshkin N., Kozhukhov O.M., Krugly Y., Lecacheux J., Pal A., Puskullu C., Szakats R., Zhukov V., Bamberger D., Mondon B., Perello C., Pratt A., Schnabel C., Selva A., Teng J.P., Tigani K., Tsamis V., Weber C., Wells G., Kalkan S., Kudak V., Marciniak A., Ogloza W., Ozdemir T., Pakstiene E., Perig V., Zejmo M. | 46361 | Astronomy and Astrophysics | 664 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
51 | 2022 | Global Trends of Decarbonisation as a Determining Factor for the Development of External Economic Activity of Metallurgical Enterprises | Levchenko N., Shyshkanova G., Abuselidze G., Zelenin Y., Prykhodko V., Kovalskyi M. | 22560939 | Rural Sustainability Research | 47 | 342 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
52 | 2022 | Application of Anti-Crisis Measures for the Sustainable Development of the Regional Economy in the Context of Doing Local Business in a Post-COVID Environment | Zavidna L., Trut O., Slobodianiuk O., Voronenko I., Vartsaba V. | 17437601 | International Journal of Sustainable Development and Planning | 17 | 5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
53 | 2022 | The character of adaptation changes in bodybuilders in conditions of sequential use of isolation and basic exercises | Chernozub A., Marionda I., Potop V., Syvokhop E., Khoma T., Spivak A., Tvelina A., Voichun H., Kovaleva N. | 22478051 | Journal of Physical Education and Sport | 22 | 8 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
54 | 2022 | Characteristics and Plasma Parameters of the Overstressed Nanosecond Discharge in Air between an Aluminum Electrode and a Chalcopyrite Electrode (СuInSe2) | Shuaibov A.K., Minya A.I., Malinina A.A., Gritsak R.V., Malinin A.N., Bilak Y.Y., Vatrala M.I. | 10683755 | Surface Engineering and Applied Electrochemistry | 58 | 4 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
55 | 2022 | Temperature dependence of the local electromagnetic field at the Fe site in multiferroic bismuth ferrite | Dang T.T., Schell J., Boa A.G., Lewin D., Marschick G., Dubey A., Escobar-Castillo M., Noll C., Beck R., Zyabkin D.V., Glukhov K., Yap I.C.J., Mokhles Gerami A., Lupascu D.C. | 24699950 | Physical Review B | 106 | 5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
56 | 2022 | Refugees and Mental health crisis in Ukraine | Shoib S., Zharkova A., Pal A., Jain N., Saleem S.M., Kolesnyk P. | 18762018 | Asian Journal of Psychiatry | 74 | 0 | 0 | 0 | 2 | 2 | 0 | 2 | ||||||||||||||||||||||
57 | 2022 | Sphenoid wing meningiomas: peritumoral brain edema as a prognostic factor in surgical outcome | Nassar A., Smolanka V., Smolanka A., Chaulagain D., Devinyak O. | 3445607 | Neurosurgical Review | 45 | 4 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
58 | 2022 | Expert model of risk assessment for the selected components of smart city concept: From safe time to pandemics as COVID-19 | Gavurova B., Kelemen M., Polishchuk V. | 380121 | Socio-Economic Planning Sciences | 82 | 0 | 0 | 0 | 6 | 6 | 0 | 6 | ||||||||||||||||||||||
59 | 2022 | Impact of structure complexity on optoelectronic and non-linear optical properties in quaternary Ag(Pb)–Ga(In)–Si(Ge)–S(Se) systems | Piasecki M., Myronchuk G., Khyzhun O.Y., Fedorchuk A., Andryievsky B., Barchyi I., Brik M. | 9258388 | Journal of Alloys and Compounds | 909 | 0 | 0 | 0 | 1 | 1 | 0 | 1 | ||||||||||||||||||||||
60 | 2022 | OPTICAL CHARACTERISTICS AND PARAMETERS OF OVERSTRESSED NANOSECOND DISCHARGE PLASMA IN ARGON BETWEEN ALUMINUM AND CHALCOPYRITE | Shuaibov O.K., Minya O.Y., Malinina A.O., Grytsak R.V., Malinin O.M. | 20710186 | Ukrainian Journal of Physics | 67 | 4 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
61 | 2022 | Express Analysis of Gas Mixtures Using a Spectral Correlator Based on the Fabry–Perot Interferometer | Kozubovsky V.R., Bilak Y.Y. | 219037 | Journal of Applied Spectroscopy | 89 | 3 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
62 | 2022 | A Complex Hybrid Model for Evaluating Projects to Improve the Sustainability and Health of Regions and Cities | Kelemen M., Gavurova B., Polishchuk V. | 16617827 | International Journal of Environmental Research and Public Health | 19 | 13 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
63 | 2022 | Genomics of Adaptation and Speciation | Wolfsberger W.W., Battistuzzi F.U., Oleksyk T.K. | 20734425 | Genes | 13 | 7 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
64 | 2022 | Renormalisation of non-differentiable potentials | Alexandre J., Defenu N., Grigolia G., Marian I.G., Mdinaradze D., Trombettoni A., Turovtsi-Shiutev Y., Nandori I. | 10298479 | Journal of High Energy Physics | 2022 | 7 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
65 | 2022 | Can the Density of Mineralized Dental Tissues (Dentin and Enamel) Be Measured and Compared with 3D Cone Beam Computed Tomography in Cases of Ectodermal Dysplasia? | Yavuz Y., Akleyin E., Dogan M.S., Goncharuk-Khomyn M., Akkus Z. | 12341010 | Medical Science Monitor | 28 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
66 | 2022 | Asteroid phase curves using sparse Gaia DR2 data and differential dense light curves | Wilawer E., Oszkiewicz D., Kryszczynska A., Marciniak A., Shevchenko V., Belskaya I., Kwiatkowski T., Kankiewicz P., Horbowicz J., Kudak V., Kulczak P., Perig V., Sobkowiak K. | 358711 | Monthly Notices of the Royal Astronomical Society | 513 | 3 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
67 | 2022 | Cathepsin B p.Gly284Val Variant in Parkinson’s Disease Pathogenesis | Milanowski L.M., Hou X., Bredenberg J.M., Fiesel F.C., Cocker L.T., Soto-Beasley A.I., Walton R.L., Strongosky A.J., Faroqi A.H., Barcikowska M., Boczarska-Jedynak M., Dulski J., Fedoryshyn L., Janik P., Potulska-Chromik A., Karpinsky K., Krygowska-Wajs A., Lynch T., Olszewska D.A., Opala G., Pulyk A., Rektorova I., Sanotsky Y., Siuda J., Widlak M., Slawek J., Rudzinska-Bar M., Uitti R., Figura M., Szlufik S., Rzonca-Niewczas S., Podgorska E., McLean P.J., Koziorowski D., Ross O.A., Hoffman-Zacharska D., Springer W., Wszolek Z.K. | 16616596 | International Journal of Molecular Sciences | 23 | 13 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
68 | 2022 | Effect of halide/pseudohalide anions on the association and semimicroextraction of substituted chloroaurates with a symmetric carbocyanine dye: A complex study and analytical application | Bazel Y., Serbin R., Sandrejova J., Fizer M., Sidey V., Balogh I. | 1677322 | Journal of Molecular Liquids | 356 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
69 | 2022 | Structural study and antibacterial activity of cetylpyridinium dodecyl sulfate ion pair | Fizer O., Filep M., Pantyo V., Elvira D., Fizer M. | 20695837 | Biointerface Research in Applied Chemistry | 12 | 3 | 0 | 0 | 1 | 1 | 2 | 1 | 3 | |||||||||||||||||||||
70 | 2022 | On Zeros of the Numerator and Denominator Polynomials of Thiele’s Continued Fraction | Pahirya M.M. | 415995 | Ukrainian Mathematical Journal | 74 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
71 | 2022 | Organic farms are the fundamental basis for the sustainable foreign economic activities of agrarians in Ukraine | Ohanisian A., Levchenko N., Shyshkanova G., Abuselidze G., Prykhodko V., Banchuk-Petrosova O. | 23540079 | Environmental and Socio-Economic Studies | 10 | 2 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
72 | 2022 | High-field conduction in fresh and aged samples of Se and As2Se3 glasses | Pal S.K., Mehta N., Horvat A.A., Mikla V.I. | 9574522 | Journal of Materials Science: Materials in Electronics | 33 | 18 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
73 | 2022 | Influence of order–disorder effects on the optical parameters of Ag7(Si1−xGe x)S5I-mixed crystals | Pogodin A.I., Pop M.M., Shender I.A., Studenyak I.P., Filep M.J., Malakhovska T.O., Kokhan O.P., Babuka T.Y., Suslikov L.M., Rubish V.M. | 9574522 | Journal of Materials Science: Materials in Electronics | 33 | 18 | 0 | 0 | 0 | 2 | 2 | 0 | 2 | |||||||||||||||||||||
74 | 2022 | Dynamic photoinduced changes of optical characteristics and effect of optical memory in amorphous As–S film-based waveguides | Kryshenik V. | 223093 | Journal of Non-Crystalline Solids | 585 | 0 | 0 | 0 | 1 | 1 | 0 | 1 | ||||||||||||||||||||||
75 | 2022 | First-Principles Calculations of Pressure Effects on the Structural, Electronic, Elastic, and Thermodynamic Properties of Rb2MF6 (M = Si, Ni, Pd) Crystals | Brik M.G., Piasecki M., Avram N.M. | 3701972 | Physica Status Solidi (B) Basic Research | 259 | 6 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
76 | 2022 | THE GENUS ATHETA (COLEOPTERA, STAPHYLINIDAE, ALEOCHARINAE) IN THE UKRAINIAN CARPATHIANS | Glotov S., Hushtan K., Hushtan H., Koval N., Diedus V. | 2707725X | Zoodiversity | 56 | 2 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
77 | 2022 | RESONANCE STRUCTURE OF CROSS-SECTIONS OF SLOW-ELECTRON SCATTERING BY CALCIUM ATOM | Gedeon V.F., Lazur V., Gedeon S.V., Yehiazarian O.V. | 20710186 | Ukrainian Journal of Physics | 67 | 3 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
78 | 2022 | Electrical properties of ceramics based on Ag7TS5I (T = Si, Ge) solid electrolytes | Studenyak I.P., Pogodin A.I., Shender I.A., Studenyak V.I., Filep M.J., Symkanych O.I., Kokhan O.P., Kus P. | 224596 | Journal of Solid State Chemistry | 309 | 0 | 0 | 0 | 2 | 2 | 0 | 2 | ||||||||||||||||||||||
79 | 2022 | NEW SELF-DUAL CODES OF LENGTH 68 FROM A 2 × 2 BLOCK MATRIX CONSTRUCTION AND GROUP RINGS | Bortos M., Gildea J., Kaya A., Korban A., Tylyshchak A. | 19305346 | Advances in Mathematics of Communications | 16 | 2 | 0 | 0 | 0 | 1 | 1 | 0 | 1 | |||||||||||||||||||||
80 | 2022 | Structural identification and stabilization of the new high-temperature phases in A(III)–B(VI) systems (A = Ga, In, B = S, Se). Part 1: High-temperature phases in the Ga–S system | Volkov V.V., Sidey V.I., Naumov A.V., Kolyshkin N.A., Kosyakov A.V., Nekrylov I.N., Brezhnev N.Y., Zavrazhnov A.Y. | 9258388 | Journal of Alloys and Compounds | 899 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
81 | 2022 | [Agent-based models: an effective tool in Ukrainian state formation and legal regulation, Modelos basados en agentes: una herramienta eficaz en la formación del Estado y la regulación legal ucraniana] | Lyubchik O.A., Yadlovska O.S., Vavzhenchuk S.Y., Korolchuk O., Stakhiv O.O. | 19006586 | Revista Cientifica General Jose Maria Cordova | 20 | 38 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
82 | 2022 | Continued fraction representation of the generating function of Bernoulli polynomials | Pahirya M.M. | 10723374 | Journal of Mathematical Sciences (United States) | 262 | 2 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
83 | 2022 | European Countries Step-up Humanitarian and Medical Assistance to Ukraine as the Conflict Continues | Jain N., Prasad S., Bordeniuc A., Tanasov A., Shirinskaya A.V., Bela B., Cheuk C.P., Banica D.C.N., Panag D.S., Swiatek D., Savchenko E., Platos E., Lolita J., Betka M.M., Phiri M., Patel S., Czarth Z.C., Krygowska A.M., Jain S., Reinis A. | 21501319 | Journal of Primary Care and Community Health | 13 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
84 | 2022 | Ex vivo confocal Raman microspectroscopy of porcine dura mater supported by optical clearing | Jaafar A., Holomb R., Sdobnov A.Y., Ocskay Z., Jakus Z., Tuchin V.V., Veres M. | 1864063X | Journal of Biophotonics | 15 | 4 | 0 | 0 | 0 | 3 | 3 | 0 | 3 | |||||||||||||||||||||
85 | 2022 | CdS nanocrystals formed in amorphous GeS2:Cd films by photoenhanced diffusion | Azhniuk Y.M., Lopushansky V.V., Solonenko D., Kryshenik V.M., Loya V.Y., Voynarovych I.M., Gomonnai A.V., Zahn D.R.T. | 21905509 | Applied Nanoscience (Switzerland) | 12 | 4 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
86 | 2022 | Supramolecular Salts of Fe(II)/Co(II)/Ni(II)/Cu(II)/Zn(II) 1,10-Phenanthroline Cations and Similar Complex Tartratostannate(IV) Anions: From Structural Features to Antimicrobial Activity and Enzyme Activation | Afanasenko E., Seifullina I., Martsinko E., Konup L., Fizer M., Gudzenko O., Borzova N. | 23656549 | ChemistrySelect | 7 | 12 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | |||||||||||||||||||||
87 | 2022 | Thrombotic Conditions in Patients with COVID-19: Dynamics of D-Dimer and Tactics of Anticoagulant Therapy | Nykonenko A.O., Podluzhniy H.S., Koliada N.A., Levchak Y.A., Hardubey Y.Yu., Zubryk I.V., Naumova O.O., Nykonenko O.S., Horlenko F.V., Matvieiev S.O., Riabokon O.V. | 26645963 | Ukrainskyi Zhurnal Sertsevo-sudynnoi Khirurhii | 30 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
88 | 2022 | Structural peculiarities of new benzopyrylium dyes: X-ray, FT-IR, and DFT complex study | Fizer M., Fizer O., Barbalat D., Shishkina S., Snigur D. | 222860 | Journal of Molecular Structure | 1252 | 0 | 0 | 0 | 3 | 3 | 0 | 3 | ||||||||||||||||||||||
89 | 2022 | QHY-174M-GPS Camera as the Device for Photometry of Artificial Satellites | Kudak V., Perig V. | 0208841X | Artificial Satellites | 57 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
90 | 2022 | Some Methods for Determining Pre-Explosive Concentrations of Gas Mixtures | Kozubovsky V.R., Bilak Y.Y. | 219037 | Journal of Applied Spectroscopy | 89 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
91 | 2022 | Crystal structure, ion transport and optical properties of new high-conductivity Ag7(Si1 − xGe x)S5I solid solutions | Pogodin A.I., Studenyak I.P., Shender I.A., Pop M.M., Filep M.J., Malakhovska T.O., Kokhan O.P., Kopcansky P., Babuka T.Y. | 222461 | Journal of Materials Science | 57 | 12 | 0 | 0 | 0 | 4 | 4 | 0 | 4 | |||||||||||||||||||||
92 | 2022 | Immunoregulatory Intestinal Microbiota and COVID-19 in Patients with Type Two Diabetes: A Double-Edged Sword | Petakh P., Kamyshna I., Nykyforuk A., Yao R., Imbery J.F., Oksenych V., Korda M., Kamyshnyi A. | 19994915 | Viruses | 14 | 3 | 0 | 0 | 0 | 2 | 2 | 0 | 2 | |||||||||||||||||||||
93 | 2022 | Participants and Victims of Armed Conflicts and Hostilities Rehabilitation: Issues and Prospects | Myronets O.M., Dei M., Korolchuk O.L., Butenko O.V., Slabetskyi O.N. | 223018 | Journal of Nervous and Mental Disease | 210 | 3 | 0 | 0 | 0 | 2 | 2 | 0 | 2 | |||||||||||||||||||||
94 | 2022 | The polarisation observables for dp elastic scattering | Zhaba V.I. | 3044289 | Pramana - Journal of Physics | 96 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
95 | 2022 | Development of a novel dispersive liquid-liquid microextraction for the determination of ergosterol in roots and various fungi samples | Kalyniukova A., Tomaskova I., Peskova V., Pastierovic F., Samek M., Balogh J. | 0026265X | Microchemical Journal | 174 | 0 | 0 | 0 | 5 | 5 | 0 | 5 | ||||||||||||||||||||||
96 | 2022 | Gold nanoparticles green synthesis with clove oil: spectroscopic and theoretical study | Fizer M.M., Mariychuk R.T., Fizer O.I. | 21905509 | Applied Nanoscience (Switzerland) | 12 | 3 | 0 | 0 | 0 | 1 | 1 | 0 | 1 | |||||||||||||||||||||
97 | 2022 | Selective bromocyclization of 5-amino-4-alkenyl-1,2,4-triazole-3-thione | Fizer M., Slivka M., Fizer O. | 20695837 | Biointerface Research in Applied Chemistry | 12 | 1 | 0 | 0 | 0 | 1 | 1 | 0 | 1 | |||||||||||||||||||||
98 | 2022 | Gold nanoparticle assisted synthesis and characterization of As–S crystallites: Scanning electron microscopy, X-ray diffraction, energy-dispersive X-ray and Raman spectroscopy combined with DFT calculations | Holomb R., Kondrat O., Mitsa V., Mitsa A., Gevczy D., Olashyn D., Himics L., Rigo I., Sadeq A.J., Mahmood M.H., Vaczi T., Czitrovszky A., Csik A., Takats V., Veres M. | 9258388 | Journal of Alloys and Compounds | 894 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||
99 | 2022 | Impact of the Main Threats from COVID-19 on the Labor Market in the Context of Ensuring Economic Security | Andriyiv N., Voloshchuk K., Petrukha S., Orlovska O., Kurylo O. | 20419031 | International Journal of Safety and Security Engineering | 12 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||
100 | 2022 | Electronic Ionization of Cytosine Molecules | Shafranyosh M.I., Zapotokova M., Sukhoviya M.I., Petrulyak V.I., Shafranyosh I.I. | 10683755 | Surface Engineering and Applied Electrochemistry | 58 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||