| A | B | C | D | E | F | G | H | I | J | K | L | M | N | O | P | Q | R | S | T | U | V | W | X | Y | Z | AA | AB | AC | AD | AE | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
1 | compound | CSID | data source | experimental or predicted | property | source value | source units | common value | common units | average | stdev | deviation (sigma) | deviation (%) | stdev/average | link | data source type | image | credit | credit link | notes | status | SMILES | donotuse | donotusebecause | instructor comments | student comments | calculation | calculation description | |||
2 | (-)-levonorgestrel | 12560 | RAEVSKY OA; PERLOVICH GL and SCHAPER K-J. Physicochemical properties/descriptors governing the solubility and partitioning of chemicals in water-solvent-gas systems. Part 2. Solubility in 1-octanol. SAR and QSAR in Environmental Research Vol. 18 Nos. 5–6 July–September 2007 543–578 | experimental | melting point | 236 | C | 509.15 | K | http://dx.doi.org/10.1080/10629360701430124 | peer reviewed journal | Andrew Lang | O=C4\C=C3/[C@@H]([C@H]2CC[C@]1([C@@H](CC[C@]1(C#C)O)[C@@H]2CC3)CC)CC4 | ||||||||||||||||||
3 | (1E,4E)-1,5-Di(2-naphthyl)-1,4-pentadien-3-one | 4523376 | Canadian Journal of Chemistry | experimental | melting point | 114 | C | 387.15 | K | http://www.nrcresearchpress.com/doi/abs/10.1139/v90-351 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/mpharvey90.png/358027629/mpharvey90.png | Matthew McBride | http://onschallenge.wikispaces.com/students | O=C(\C=C\c2ccc1c(cccc1)c2)\C=C\c2ccc1c(cccc1)c2 | x | clearly out of range MJM | ||||||||||||||
4 | (1E,4E)-1,5-Di(2-naphthyl)-1,4-pentadien-3-one | 4523376 | Tetrahedron | experimental | melting point | 243.5 | C | 516.65 | K | http://dx.doi.org/10.1016/0040-4020(96)00788-0 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/mpseifert96.png/358028521/mpseifert96.png | Matthew McBride | http://onschallenge.wikispaces.com/students | O=C(\C=C\c2ccc1c(cccc1)c2)\C=C\c2ccc1c(cccc1)c2 | ||||||||||||||||
5 | (1E,4E)-1,5-Di(2-naphthyl)-1,4-pentadien-3-one | 4523376 | Patent | experimental | melting point | 245 | C | 518.15 | K | http://appft1.uspto.gov/netacgi/nph-Parser?Sect1=PTO1&Sect2=HITOFF&d=PG01&p=1&u=%2Fnetahtml%2FPTO%2Fsrchnum.html&r=1&f=G&l=50&s1=%2220100152493%22.PGNR.&OS=DN/20100152493&RS=DN/20100152493 | patent | http://onschallenge.wikispaces.com/file/view/mppatent.png/358027107/mppatent.png | Matthew McBride | http://onschallenge.wikispaces.com/students | O=C(\C=C\c2ccc1c(cccc1)c2)\C=C\c2ccc1c(cccc1)c2 | ||||||||||||||||
6 | (1E,4E)-1,5-Di(2-naphthyl)-1,4-pentadien-3-one | 4523376 | Journal of the American Chemical Society | experimental | melting point | 242 | C | 515.15 | K | http://pubs.acs.org/doi/abs/10.1021/ja00233a004 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/mpikeda87.png/358027393/mpikeda87.png | Matthew McBride | http://onschallenge.wikispaces.com/students | O=C(\C=C\c2ccc1c(cccc1)c2)\C=C\c2ccc1c(cccc1)c2 | ||||||||||||||||
7 | (2E)-1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one | 553827 | European Journal of Pharmaceutical Sciences | experimental | melting point | 87.5-88 | C | 360.9 | K | http://www.sciencedirect.com/science/article/pii/S0928098708002911 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/han.png/305308516/han.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
8 | (2E)-1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one | 553827 | Chemical & Pharmaceutical Bulletin | experimental | melting point | 89 | C | 362.15 | K | http://www.jstage.jst.go.jp/article/cpb/54/10/1384/_pdf | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Subbiah.png/305309710/Subbiah.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
9 | (2E)-1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one | 553827 | Tetrahedron | experimental | melting point | 81-83 | C | 355.15 | K | http://tinyurl.com/7983shq | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Barros.png/305311144/Barros.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
10 | (2E)-1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one | 553827 | Journal of Pharmacy and Pharmacology | experimental | melting point | 83-84 | C | 356.65 | K | http://onlinelibrary.wiley.com/doi/10.1111/j.2042-7158.1997.tb06837.x/pdf | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Chun.png/305312474/Chun.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
11 | (2E)-1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one | 553827 | Biological & Pharmaceutical Bulletin; | experimental | melting point | 82-84 | C | 356.15 | K | http://tinyurl.com/6sa8xpl | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Iwata2.png/305314066/Iwata2.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
12 | (2E)-1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one | 553827 | Tetrahedron | experimental | melting point | 82-85 | C | 356.65 | K | http://tinyurl.com/87f5k47 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Ugo.png/305315050/Ugo.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
13 | (2E)-1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one | 553827 | Journal of Medicinal Chemistry | experimental | melting point | 82-85 | C | 356.65 | K | http://pubs.acs.org/doi/pdf/10.1021/jm00076a019 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/sogawa2.png/305316190/sogawa2.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
14 | (2E)-1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one | 553827 | Bulletin of the Chemical Society of Japan | experimental | melting point | 86-88 | C | 360.15 | K | http://tinyurl.com/7gjbd8o | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Sekizaki.png/305316874/Sekizaki.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
15 | (2E)-1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one | 553827 | Bulletin of the Chemical Society of Japan | experimental | melting point | 90-91 | C | 363.65 | K | http://tinyurl.com/8xx64wg | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Ryoka.png/305318240/Ryoka.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
16 | (2E)-1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one | 553827 | Tetrahedron | experimental | melting point | 87-88 | C | 360.65 | K | http://tinyurl.com/7pwl3se | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Casiraghi.png/305319582/Casiraghi.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
17 | (2E)-1-(3-Hydroxyphenyl)-3-(2-nitrophenyl)-2-propen-1-one | 7730515 | Tetrahedron Letters | experimental | melting point | 187-189 | C | 461.15 | K | http://tinyurl.com/7ggpjtz | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Narender.png/305322000/Narender.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=CC(=C1)C(\C=C\C2=C(C=CC=C2)[N+](=O)[O-])=O | |||||||||||||||
18 | (2E)-1-(4-Hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one | 4511547 | European Journal of Medicinal Chemistry | experimental | melting point | 190 | C | 463.15 | K | http://tinyurl.com/7hc88zs | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Montes2.png/305282802/Montes2.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
19 | (2E)-1-(4-Hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one | 4511547 | Bioorganic and Medicinal Chemistry | experimental | melting point | 168-170 | C | 442.15 | K | http://tinyurl.com/84582mh | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Montes2.png/305282802/Montes2.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
20 | (2E)-1-(4-Hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one | 4511547 | Chemical and Pharmaceutical Bulletin | experimental | melting point | 182 | C | 455.15 | K | http://www.jstage.jst.go.jp/article/cpb/56/12/1675/_pdf | Chemical Bulletin | http://onschallenge.wikispaces.com/file/view/Inci.png/305285290/Inci.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
21 | (2E)-1-(4-Hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one | 4511547 | Organic Letters | experimental | melting point | 185-188 | C | 459.65 | K | http://pubs.acs.org/doi/suppl/10.1021/ol0602708 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Bowman.png/305287520/Bowman.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | mp in supporting info | ||||||||||||||
22 | (2E)-1-(4-Hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one | 4511547 | Patent: US2006/142303 A1 | experimental | melting point | 184-185 | C | 457.65 | K | http://tinyurl.com/7rhk7aa | patent | http://onschallenge.wikispaces.com/file/view/pat.png/305289748/pat.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
23 | (2E)-1-(4-Hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one | 4511547 | Indian Journal of Chemistry; Section B: Organic Chemistry Including Medicinal Chemistry, | experimental | melting point | 182 | C | 455.15 | K | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Malik.png/305290806/Malik.png | Matthew McBride | http://onschallenge.wikispaces.com/students | Not completed | OC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | Need to get paper | |||||||||||||||
24 | (2E)-1-(4-Hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one | 4511547 | Journal of Medicinal Chemistry | experimental | melting point | 188.2-189.4 | C | 461.95 | K | http://pubs.acs.org/doi/pdf/10.1021/jm0101747 | peer reviewed journal | Matthew McBride | http://onschallenge.wikispaces.com/students | Not completed | OC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | Unable to find mp in paper | |||||||||||||||
25 | (2E)-1-(4-Hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one | 4511547 | Journal of Medicinal Chemistry | experimental | melting point | 180-182 | C | 454.15 | K | http://pubs.acs.org/doi/pdf/10.1021/jm970432t | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Dimmock.png/305304348/Dimmock.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
26 | (2E)-1-(4-Hydroxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one | 4511547 | Biological & Pharmaceutical Bulletin | experimental | melting point | 188-190 | C | 462.15 | K | http://tinyurl.com/6sa8xpl | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Iwata.png/305305966/Iwata.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
27 | (2E)-1,3-Bis-(4-methoxyphenyl)-2-propen-1-one | 4526784 | Beilstein Journal of Organic Chemistry | experimental | melting point | 94-96 | C | 368.15 | K | http://www.beilstein-journals.org/bjoc/single/articleFullText.htm?publicId=1860-5397-7-198#supporting-info | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/supmat3.png/309890980/supmat3.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | COC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
28 | (2E)-1,3-Bis-(4-methoxyphenyl)-2-propen-1-one | 4526784 | Tetrahedron | experimental | melting point | 103-104 | C | 376.65 | K | http://www.sciencedirect.com/science/article/pii/S0040402010014547 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/supmat4.png/309892148/supmat4.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | COC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
29 | (2E)-1,3-Bis-(4-methoxyphenyl)-2-propen-1-one | 4526784 | Bioorganic and Medicinal Chemistry | experimental | melting point | 98-100 | C | 372.15 | K | http://www.sciencedirect.com/science/article/pii/S0968089609002028 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Montes4.png/309893252/Montes4.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | COC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
30 | (2E)-1,3-Bis-(4-methoxyphenyl)-2-propen-1-one | 4526784 | Bioorganic and Medicinal Chemistry | experimental | melting point | 100-102 | C | 374.15 | K | http://www.sciencedirect.com/science/article/pii/S0968089609008918 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/supmat5.png/309894670/supmat5.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | COC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
31 | (2E)-1,3-Bis-(4-methoxyphenyl)-2-propen-1-one | 4526784 | Journal of Organometallic Chemistry | experimental | melting point | 94-96 | C | 368.15 | K | http://www.sciencedirect.com/science/article/pii/S0022328X08002921 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Rao2.png/309895666/Rao2.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | COC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
32 | (2E)-1,3-Bis-(4-methoxyphenyl)-2-propen-1-one | 4526784 | Organic Letters | experimental | melting point | 89-90 | C | 362.65 | K | http://pubs.acs.org/doi/full/10.1021/ol0602708 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/supmat6.png/309896880/supmat6.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | COC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
33 | (2E)-1,3-Bis-(4-methoxyphenyl)-2-propen-1-one | 4526784 | Phytochemistry (Elsevier) | experimental | melting point | 102-103 | C | 375.65 | K | http://www.sciencedirect.com/science/article/pii/003194228883070X | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Ohashi_.png/309898310/Ohashi_.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | COC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
34 | (2E)-1,3-Bis-(4-methoxyphenyl)-2-propen-1-one | 4526784 | Canadian Journal of Chemistry | experimental | melting point | 99 | C | 372.15 | K | http://www.nrcresearchpress.com/doi/abs/10.1139/v64-377 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Wheeler.png/309899064/Wheeler.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | COC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
35 | (2E)-1,3-Bis-(4-methoxyphenyl)-2-propen-1-one | 4526784 | Journal of the American Chemical Society | experimental | melting point | 100-101 | C | 373.65 | K | http://pubs.acs.org/doi/abs/10.1021/ja01859a046 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Richardson.png/309899966/Richardson.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | COC1=CC=C(C=C1)C(\C=C\C2=CC=C(C=C2)OC)=O | |||||||||||||||
36 | (2E)-1,3-Diphenyl-2-propen-1-one | 553346 | Journal of Medicinal Chemistry | experimental | melting point | 163-164 | C | 436.65 | K | http://pubs.acs.org/doi/suppl/10.1021/jm801590u/suppl_file/jm801590u_si_001.pdf | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Chimenti.png/305336098/Chimenti.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)C(\C=C\C2=CC=CC=C2)=O | x | out of range | |||||||||||||
37 | (2E)-1,3-Diphenyl-2-propen-1-one | 553346 | Journal of Fluorine Chemistry | experimental | melting point | 56-58 | C | 330.15 | K | http://tinyurl.com/6s9g8la | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Zhu.png/305325116/Zhu.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
38 | (2E)-1,3-Diphenyl-2-propen-1-one | 553346 | European Journal of Organic Chemistry | experimental | melting point | 53-54 | C | 326.65 | K | http://onlinelibrary.wiley.com/doi/10.1002/ejoc.201001379/pdf | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Fang.png/305326476/Fang.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)C(\C=C\C2=CC=CC=C2)=O | mp in supporting info | ||||||||||||||
39 | (2E)-1,3-Diphenyl-2-propen-1-one | 553346 | European Journal of Medicinal Chemistry | experimental | melting point | 57 | C | 330.15 | K | http://tinyurl.com/6ncetth | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/hayat.png/305327176/hayat.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
40 | (2E)-1,3-Diphenyl-2-propen-1-one | 553346 | Ultrasonics Sonochemistry | experimental | melting point | 56-58 | C | 330.15 | K | http://tinyurl.com/7r9rhya | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Chtourou.png/305328554/Chtourou.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
41 | (2E)-1,3-Diphenyl-2-propen-1-one | 553346 | Electrochimica Acta | experimental | melting point | 54-56 | C | 328.15 | K | http://tinyurl.com/6lwyvqd | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Gutierrez.png/305329796/Gutierrez.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
42 | (2E)-1,3-Diphenyl-2-propen-1-one | 553346 | Journal of Fluorine Chemistry | experimental | melting point | 56-57 | C | 329.65 | K | http://tinyurl.com/7vpzedm | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Yi.png/305331110/Yi.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
43 | (2E)-1,3-Diphenyl-2-propen-1-one | 553346 | European Journal of Organic Chemistry | experimental | melting point | 55-57 | C | 329.15 | K | http://onlinelibrary.wiley.com/doi/10.1002/ejoc.200900288/pdf | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Thiot.png/305333684/Thiot.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
44 | (2E)-1,3-Diphenyl-2-propen-1-one | 553346 | Chemistry--A European Journal | experimental | melting point | 55-56 | C | 328.65 | K | http://onlinelibrary.wiley.com/doi/10.1002/chem.200900177/suppinfo | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Liu2.png/305335064/Liu2.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
45 | (2E)-1,3-Diphenyl-2-propen-1-one | 553346 | Journal of Organometallic Chemistry | experimental | melting point | 56-57 | C | 329.65 | K | http://tinyurl.com/7t3vh38 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Safa.png/305337406/Safa.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)C(\C=C\C2=CC=CC=C2)=O | |||||||||||||||
46 | (2E)-3-(3,4-Dihydroxyphenyl)-1-phenyl-2-propen-1-one | 4976780 | Bioorganic & Medicinal Chemistry Letters | experimental | melting point | 212-213 | C | 485.65 | K | http://www.sciencedirect.com/science/article/pii/S0960894X05011315 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Seo2.png/311393548/Seo2.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC(=C1)\C=C\C(=O)C2=CC=CC=C2)O | In supplemental information | ||||||||||||||
47 | (2E)-3-(3,4-Dihydroxyphenyl)-1-phenyl-2-propen-1-one | 4976780 | Journal of Medicinal Chemistry | experimental | melting point | 199-201 | C | 473.15 | K | http://pubs.acs.org/doi/full/10.1021/jm9707232 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/10D.png/311394922/10D.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC(=C1)\C=C\C(=O)C2=CC=CC=C2)O | |||||||||||||||
48 | (2E)-3-(3,4-Dihydroxyphenyl)-1-phenyl-2-propen-1-one | 4976780 | Journal of Pharmacy and Pharmacology | experimental | melting point | 203-204 | C | 476.65 | K | http://onlinelibrary.wiley.com/doi/10.1111/j.2042-7158.1997.tb06837.x/pdf | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/lin7.png/311396210/lin7.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC(=C1)\C=C\C(=O)C2=CC=CC=C2)O | |||||||||||||||
49 | (2E)-3-(3,4-Dihydroxyphenyl)-1-phenyl-2-propen-1-one | 4976780 | Journal of Medicinal Chemistry | experimental | melting point | 202-204 | C | 476.15 | K | http://pubs.acs.org/doi/pdf/10.1021/jm00076a019 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/sogawa3.png/311397680/sogawa3.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=CC(=C1)\C=C\C(=O)C2=CC=CC=C2)O | |||||||||||||||
50 | (2E)-3-(3,4-Dihydroxyphenyl)-1-phenyl-2-propen-1-one | 4976780 | Journal of the American Chemical Society | experimental | melting point | 204-205 | C | 477.65 | K | http://pubs.acs.org/doi/pdf/10.1021/ja01208a051 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Geissman_.png/311398786/Geissman_.png | Matthew McBride | http://onschallenge.wikispaces.com/students | Decomposed | done | OC1=C(C=CC(=C1)\C=C\C(=O)C2=CC=CC=C2)O | ||||||||||||||
51 | (2E)-3-(4-Chlorophenyl)-1-(4-methoxyphenyl)-2-propen-1-one | 4462926 | Bioorganic and Medicinal Chemistry | experimental | melting point | 86-88 | C | 360.15 | K | http://tinyurl.com/84582mh | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Montes.png/305275782/Montes.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | ClC1=CC=C(C=C1)\C=C\C(=O)C2=CC=C(C=C2)OC | |||||||||||||||
52 | (2E)-3-(4-Chlorophenyl)-1-(4-methoxyphenyl)-2-propen-1-one | 4462926 | Journal of Medicinal Chemistry | experimental | melting point | 125-126 | C | 398.65 | K | http://pubs.acs.org/doi/suppl/10.1021/jm801590u/suppl_file/jm801590u_si_001.pdf | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Franco.png/305276976/Franco.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | ClC1=CC=C(C=C1)\C=C\C(=O)C2=CC=C(C=C2)OC | mp in supporting info | ||||||||||||||
53 | (2E)-3-(4-Chlorophenyl)-1-(4-methoxyphenyl)-2-propen-1-one | 4462926 | Journal of Organometallic Chemistry | experimental | melting point | 129-131 | C | 403.15 | K | http://tinyurl.com/83933og | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Rao.png/305278896/Rao.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | ClC1=CC=C(C=C1)\C=C\C(=O)C2=CC=C(C=C2)OC | |||||||||||||||
54 | (2E)-3-(4-Hydroxy-3-methoxyphenyl)-1-(2-hydroxyphenyl)-2-propen-1-one | 4767768 | European Journal of Medicinal Chemistry | experimental | melting point | 128-130 | C | 402.15 | K | http://tinyurl.com/7r8qh85 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/arty.png/305248952/arty.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=C(C=C1)\C=C\C(=O)C2=C(C=CC=C2)O)OC | |||||||||||||||
55 | (2E)-3-(4-Hydroxy-3-methoxyphenyl)-1-(2-hydroxyphenyl)-2-propen-1-one | 4767768 | Journal of Medicinal Chemistry | experimental | melting point | 126-127 | C | 399.65 | K | http://pubs.acs.org/doi/pdf/10.1021/jm00076a019 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Sogawa.png/305250472/Sogawa.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=C(C=C1)\C=C\C(=O)C2=C(C=CC=C2)O)OC | |||||||||||||||
56 | (2E)-3-(4-Hydroxy-3-methoxyphenyl)-1-(2-hydroxyphenyl)-2-propen-1-one | 4767768 | Journal of the American Chemical Society | experimental | melting point | 129 | C | 402.15 | K | http://pubs.acs.org/doi/pdf/10.1021/ja01133a531 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Sen.png/305251634/Sen.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=C(C=C(C=C1)\C=C\C(=O)C2=C(C=CC=C2)O)OC | |||||||||||||||
57 | (2E)-3-(4-Hydroxy-3-methoxyphenyl)-1-(2-hydroxyphenyl)-2-propen-1-one | 4767768 | Journal of the Chemical Society | experimental | melting point | 128 | C | 401.15 | K | http://pubs.rsc.org/en/Content/ArticleLanding/1937/JR/jr9370000421 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Russell.png/305252544/Russell.png | Matthew McBride | http://onschallenge.wikispaces.com/students | Not completed | OC1=C(C=C(C=C1)\C=C\C(=O)C2=C(C=CC=C2)O)OC | Need to get paper | ||||||||||||||
58 | (2E)-3-(4-Hydroxyphenyl)-1-phenyl-2-propen-1-one | 4445524 | Bioorganic & Medicinal Chemistry Letters | experimental | melting point | 187-188 | C | 460.65 | K | http://www.sciencedirect.com/science/article/pii/S0960894X05011315 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/seo.png/309870488/seo.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
59 | (2E)-3-(4-Hydroxyphenyl)-1-phenyl-2-propen-1-one | 4445524 | Molecular Crystals and Liquid Crystals Science and Technology; Section A: Molecular Crystals and Liquid Crystals | experimental | melting point | 185 | C | 458.15 | K | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Mihara.png/309871346/Mihara.png | Matthew McBride | http://onschallenge.wikispaces.com/students | Not completed | OC1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | Need paper | |||||||||||||||
60 | (2E)-3-(4-Hydroxyphenyl)-1-phenyl-2-propen-1-one | 4445524 | Journal of Medicinal Chemistry | experimental | melting point | 180-181 | C | 453.65 | K | http://pubs.acs.org/doi/abs/10.1021/jm970432t | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Dimmock2.png/309872416/Dimmock2.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
61 | (2E)-3-(4-Hydroxyphenyl)-1-phenyl-2-propen-1-one | 4445524 | Pharmaceutical Research | experimental | melting point | 178-180 | C | 452.15 | K | http://www.springerlink.com/content/r6q63540r0023u37/fulltext.pdf | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Hsieh.png/309873152/Hsieh.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
62 | (2E)-3-(4-Hydroxyphenyl)-1-phenyl-2-propen-1-one | 4445524 | Biological & Pharmaceutical Bulletin | experimental | melting point | 184 | C | 457.15 | K | 10.1248/bpb.18.1710 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Iwata4.png/309874726/Iwata4.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
63 | (2E)-3-(4-Hydroxyphenyl)-1-phenyl-2-propen-1-one | 4445524 | Journal of the American Chemical Society | experimental | melting point | 183-184 | C | 456.65 | K | http://pubs.acs.org/doi/abs/10.1021/ja01369a057 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Shriner.png/309875800/Shriner.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | OC1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
64 | (2E)-3-(4-Hydroxyphenyl)-1-phenyl-2-propen-1-one | 4445524 | J. Gen. Chem. USSR (Engl. Transl.) | experimental | melting point | 183.5-184.5 | C | 457.15 | K | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Khimii.png/309876618/Khimii.png | Matthew McBride | http://onschallenge.wikispaces.com/students | Not completed | OC1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | Need paper | |||||||||||||||
65 | (2E)-3-(4-Nitrophenyl)-1-phenyl-2-propen-1-one | 4526395 | Journal of Fluorine Chemistry | experimental | melting point | 158-159 | C | 431.65 | K | http://www.sciencedirect.com/science/article/pii/S0022113910002630 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Zhu2.png/309879304/Zhu2.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | [N+](=O)([O-])C1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
66 | (2E)-3-(4-Nitrophenyl)-1-phenyl-2-propen-1-one | 4526395 | Bioorganic and Medicinal Chemistry | experimental | melting point | 160-161 | C | 433.65 | K | http://www.sciencedirect.com/science/article/pii/S0968089611000770 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/SupMat.png/309880470/SupMat.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | [N+](=O)([O-])C1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
67 | (2E)-3-(4-Nitrophenyl)-1-phenyl-2-propen-1-one | 4526395 | Medicinal Chemistry Research | experimental | melting point | 164 | C | 437.15 | K | http://www.springerlink.com/content/8360777212q3g258/fulltext.pdf | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Begum.png/309881356/Begum.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | [N+](=O)([O-])C1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
68 | (2E)-3-(4-Nitrophenyl)-1-phenyl-2-propen-1-one | 4526395 | Journal of Molecular Catalysis B: Enzymatic | experimental | melting point | 160 | C | 433.15 | K | http://www.sciencedirect.com/science/article/pii/S1381117710000123 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Silva2.png/309882126/Silva2.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | [N+](=O)([O-])C1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
69 | (2E)-3-(4-Nitrophenyl)-1-phenyl-2-propen-1-one | 4526395 | Chemistry--A European Journal | experimental | melting point | 166-168 | C | 440.15 | K | http://onlinelibrary.wiley.com/doi/10.1002/chem.201000883/suppinfo | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/sepmat2.png/309882662/sepmat2.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | [N+](=O)([O-])C1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
70 | (2E)-3-(4-Nitrophenyl)-1-phenyl-2-propen-1-one | 4526395 | Bioorganic and Medicinal Chemistry | experimental | melting point | 155-157 | C | 429.15 | K | http://www.sciencedirect.com/science/article/pii/S0968089609002028 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Montes3.png/309883824/Montes3.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | [N+](=O)([O-])C1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
71 | (2E)-3-(4-Nitrophenyl)-1-phenyl-2-propen-1-one | 4526395 | Journal of Organic Chemistry | experimental | melting point | 163.5-164 | C | 436.9 | K | http://pubs.acs.org/doi/abs/10.1021/jo972163k | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/ogino.png/309886396/ogino.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | [N+](=O)([O-])C1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
72 | (2E)-3-(4-Nitrophenyl)-1-phenyl-2-propen-1-one | 4526395 | Journal of the American Chemical Society | experimental | melting point | 159-160 | C | 432.65 | K | http://pubs.acs.org/doi/pdf/10.1021/ja00901a027 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/speziale.png/309887968/speziale.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | [N+](=O)([O-])C1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
73 | (2E)-3-(4-Nitrophenyl)-1-phenyl-2-propen-1-one | 4526395 | Journal of the American Chemical Society | experimental | melting point | 164.1-164.5 | C | 437.45 | K | http://pubs.acs.org/doi/pdf/10.1021/ja01512a028 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Noyce.png/309888628/Noyce.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | [N+](=O)([O-])C1=CC=C(C=C1)\C=C\C(=O)C2=CC=CC=C2 | |||||||||||||||
74 | (2E)-3-Benzo[1,3]dioxol-5-yl-1-phenyl-2-propen-1-one | 4510679 | Journal of Molecular Catalysis B: Enzymatic | experimental | melting point | 118 | C | 391.15 | K | http://tinyurl.com/7oaeuwd | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Silva.png/305231792/Silva.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | O1C2=C(OC1)C=C(C=C2)\C=C\C(=O)C3=CC=CC=C3 | |||||||||||||||
75 | (2E)-3-Benzo[1,3]dioxol-5-yl-1-phenyl-2-propen-1-one | 4510679 | Bioorganic & Medicinal Chemistry Letters | experimental | melting point | 115-117 | C | 389.15 | K | http://tinyurl.com/7e8smyz | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Chiaradia.png/305234306/Chiaradia.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | O1C2=C(OC1)C=C(C=C2)\C=C\C(=O)C3=CC=CC=C3 | Value is located under Supplementary data (a download) | ||||||||||||||
76 | (2E)-3-Benzo[1,3]dioxol-5-yl-1-phenyl-2-propen-1-one | 4510679 | Journal of Organic Chemistry | experimental | melting point | 108 | C | 381.15 | K | http://pubs.acs.org/doi/pdf/10.1021/jo051373r | peer reviewed journal | Matthew McBride | http://onschallenge.wikispaces.com/students | Could not be found in paper | Not completed | O1C2=C(OC1)C=C(C=C2)\C=C\C(=O)C3=CC=CC=C3 | Compound in paper; but no mp listed (15) | ||||||||||||||
77 | (2E)-3-Benzo[1,3]dioxol-5-yl-1-phenyl-2-propen-1-one | 4510679 | Journal of Heterocyclic Chemistry | experimental | melting point | 109-110 | C | 382.65 | K | http://onlinelibrary.wiley.com/doi/10.1002/jhet.5570330209/abstract | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Ibanez.png/305238068/Ibanez.png | Matthew McBride | http://onschallenge.wikispaces.com/students | Not completed | O1C2=C(OC1)C=C(C=C2)\C=C\C(=O)C3=CC=CC=C3 | Need to get paper: requested | ||||||||||||||
78 | (2E)-3-Benzo[1,3]dioxol-5-yl-1-phenyl-2-propen-1-one | 4510679 | Chem.Abstr. | experimental | melting point | 122 | C | 395.15 | K | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Ishiwata.png/305238948/Ishiwata.png | Matthew McBride | http://onschallenge.wikispaces.com/students | Not completed | O1C2=C(OC1)C=C(C=C2)\C=C\C(=O)C3=CC=CC=C3 | Need to get paper | |||||||||||||||
79 | (2E)-3-Benzo[1,3]dioxol-5-yl-1-phenyl-2-propen-1-one | 4510679 | Agricultural and Biological Chemistry | experimental | melting point | 120-121 | C | 393.65 | K | http://tinyurl.com/77qo4cz | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Mukerjee.png/305241490/Mukerjee.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | O1C2=C(OC1)C=C(C=C2)\C=C\C(=O)C3=CC=CC=C3 | |||||||||||||||
80 | (2E)-3-Benzo[1,3]dioxol-5-yl-1-phenyl-2-propen-1-one | 4510679 | Bulletin of the Chemical Society of Japan | experimental | melting point | 121 | C | 394.15 | K | http://tinyurl.com/7l4l643 | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Asahina.png/305243126/Asahina.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | O1C2=C(OC1)C=C(C=C2)\C=C\C(=O)C3=CC=CC=C3 | |||||||||||||||
81 | (2E)-3-Benzo[1,3]dioxol-5-yl-1-phenyl-2-propen-1-one | 4510679 | Journal fuer Praktische Chemie (Leipzig) | experimental | melting point | 122 | C | 395.15 | K | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Stobbe.png/305244434/Stobbe.png | Matthew McBride | http://onschallenge.wikispaces.com/students | Not completed | O1C2=C(OC1)C=C(C=C2)\C=C\C(=O)C3=CC=CC=C3 | Need to get paper | |||||||||||||||
82 | (2E)-3-Benzo[1,3]dioxol-5-yl-1-phenyl-2-propen-1-one | 4510679 | Annales de Chimie (Cachan; France | experimental | melting point | 128 | C | 401.15 | K | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Albesco.png/305245694/Albesco.png | Matthew McBride | http://onschallenge.wikispaces.com/students | Not completed | O1C2=C(OC1)C=C(C=C2)\C=C\C(=O)C3=CC=CC=C3 | Need to get paper | |||||||||||||||
83 | (2R,3S,4R,5S,6S)-2-Cyano-6-methyltetrahydro-2H-pyran-3,4,5-triyl triacetate | Journal of Carbohydrate Chemistry | experimental | melting point | 129-130 | C | 402.65 | K | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/Huu.png/309901714/Huu.png | Matthew McBride | http://onschallenge.wikispaces.com/students | Not completed | C(C)(=O)O[C@@H]1[C@@H]([C@H]([C@@H](O[C@@H]1C#N)C)OC(C)=O)OC(C)=O | Need paper | ||||||||||||||||
84 | (2S)-1-amino-2-propanol | 5641722 | Merck Millipore | experimental | melting point | 21.5 | C | 294.65 | K | http://www.merckmillipore.com/united-kingdom/chemicals/s-plus-1-amino-2-propanol/MDA_CHEM-818231/p_uuid | chemical vendor | Andrew Lang | http://en.wikipedia.org/wiki/Andrew_S.I.D._Lang | C[C@@H](CN)O | |||||||||||||||||
85 | (2S)-1-amino-2-propanol | 5641722 | Synquest Labs | experimental | melting point | 22.5 | C | 295.65 | K | http://synquestlabs.com/product/id/78657.html | chemical vendor | Andrew Lang | http://en.wikipedia.org/wiki/Andrew_S.I.D._Lang | C[C@@H](CN)O | |||||||||||||||||
86 | (2S)-1-amino-2-propanol | 5641722 | Alfa Aesar | experimental | melting point | 25 | C | 298.15 | K | http://www.alfa.com/en/GP100W.pgm?DSSTK=L14102 | chemical vendor | Andrew Lang | http://en.wikipedia.org/wiki/Andrew_S.I.D._Lang | C[C@@H](CN)O | |||||||||||||||||
87 | (E)-2-(2-Fluorophenyl)-3-(2-nitrophenyl)propenoic acid | Arkivoc | experimental | melting point | 210-215 | C | 485.65 | K | http://www.arkat-usa.org/get-file/41664/ | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/gy1e.png/305951288/gy1e.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | FC1=C(C=CC=C1)\C(C(=O)O)=C/C2=C(C=CC=C2)[N+](=O)[O-] | ||||||||||||||||
88 | (E)-2-(4-Fluorophenyl)-3-(4-nitrophenyl)propenoic acid | Arkivoc | experimental | melting point | 242-243 | C | 515.65 | K | http://www.arkat-usa.org/get-file/41664/ | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/gy1b.png/305949628/gy1b.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | FC1=CC=C(C=C1)\C(C(=O)O)=C/C2=CC=C(C=C2)[N+](=O)[O-] | ||||||||||||||||
89 | (E)-2-(4-nitrophenyl)-3-phenylpropenoic acid | Arkivoc | experimental | melting point | 227-228 | C | 500.65 | K | http://www.arkat-usa.org/get-file/41664/ | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/gy1f.png/305947444/gy1f.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | [N+](=O)([O-])C1=CC=C(C=C1)\C(C(=O)O)=C/C2=CC=CC=C2 | ||||||||||||||||
90 | (E)-2-phenyl-3-(2-nitrophenyl)propenoic acid | Arkivoc | experimental | melting point | 197-200 | C | 471.65 | K | http://www.arkat-usa.org/get-file/41664/ | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/gy1d.png/305945330/gy1d.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)\C(C(=O)O)=C/C2=C(C=CC=C2)[N+](=O)[O-] | ||||||||||||||||
91 | (E)-2-phenyl-3-(3-nitrophenyl)propenoic acid | Arkivoc | experimental | melting point | 184-186 | C | 458.15 | K | http://www.arkat-usa.org/get-file/41664/ | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/gy1c.png/305943732/gy1c.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)\C(C(=O)O)=C/C2=CC(=CC=C2)[N+](=O)[O-] | ||||||||||||||||
92 | (E)-2-phenyl-3-(4-nitrophenyl)propenoic acid | Arkivoc | experimental | melting point | 214-217 | C | 488.65 | K | http://www.arkat-usa.org/get-file/41664/ | peer reviewed journal | http://onschallenge.wikispaces.com/file/view/gy1a.png/305941728/gy1a.png | Matthew McBride | http://onschallenge.wikispaces.com/students | done | C1(=CC=CC=C1)\C(C(=O)O)=C/C2=CC=C(C=C2)[N+](=O)[O-] | ||||||||||||||||
93 | 1-adamantylamine | 2045 | EPISuite-ChemSpider | experimental | melting point | 180 | °C | 453.15 | K | http://chemspider.com/2045 | government database | Andrew Lang | http://en.wikipedia.org/wiki/Andrew_S.I.D._Lang | C1C2CC3CC1CC(C2)(C3)N | |||||||||||||||||
94 | 1-benzylimidazole | 70309 | Mannhold R.; Poda G. I.; Ostermann C.; Tetko I. V. Calculation of molecular lipophilicity: State-of-the-art and comparison of log P methods on more than 96000 compounds J. Pharm. Sci. 2009 98 (3) 861-93 | experimental | logP | 1.6 | 1.6 | - | http://vcclab.org/articles/96000.pdf | peer reviewed journal | Andrew Lang | n1ccn(c1)Cc2ccccc2 | |||||||||||||||||||
95 | 1-butene | 7556 | Yamamuro O; Matsuo T; Takeda K; Kanaya T; Kawaguchi T; Kaji K Journal of Chemical Physics; 105(2); 732-737 (1996) | experimental | melting point | 87.8 | K | 87.8 | K | http://jcp.aip.org/resource/1/jcpsa6/v105/i2/p732_s1 | peer reviewed journal | Evan Curtin | http://onschallenge.wikispaces.com/students | C=CCC | |||||||||||||||||
96 | 1-Chloroanthraquinone | 6453 | Abraham M.H. and Acree Jr. W.E. The solubility of liquid and solid compounds in dry octan-1-ol. Chemosphere (2013) | experimental | melting point | 159 | C | 432.15 | K | http://dx.doi.org/10.1016/j.chemosphere.2013.10.095 | peer reviewed journal | Andrew Lang | http://en.wikipedia.org/wiki/Andrew_S.I.D._Lang | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)Cl | |||||||||||||||||
97 | 1-decene | 12809 | NIST Web Book | experimental | melting point | 207 | K | 207 | K | http://webbook.nist.gov/cgi/cbook.cgi?ID=C872059&Units=SI&Mask=7 | government database | Evan Curtin | http://onschallenge.wikispaces.com/students | average of 6 | C=CCCCCCCCC | ||||||||||||||||
98 | 1-fluoro-2,4,6-trimethylbenzene | 21241935 | Alfa Aesar | experimental | boiling point | 163-165 | degrees | 437.15 | K | http://www.alfa.com/en/GP100W.pgm?DSSTK=A12779 | chemical vendor | http://cheminfo2012.wikispaces.com/file/view/1-fluoro-2%2C4%2C6-trimethylbenzene+alfa+aesar.jpg/380499444/1-fluoro-2%2C4%2C6-trimethylbenzene%20alfa%20aesar.jpg | Kayla Gogarty | http://onschallenge.wikispaces.com/students | assume C as source units | Cc1cc(C)c(F)c(C)c1 | |||||||||||||||
99 | 1-heptanol | 7837 | CRC Handbook of Chemistry and Physics | experimental | melting point | -33.2 | C | 239.95 | K | http://www.hbcpnetbase.com/ | commercial database | Jean-Claude Bradley | http://usefulchem.blogspot.com | CCCCCCCO | |||||||||||||||||
100 | 1-heptene | 11121 | NIST Web Book | experimental | melting point | 153 | K | 153 | K | http://webbook.nist.gov/cgi/cbook.cgi?ID=C592767&Units=SI&Mask=7 | government database | Evan Curtin | http://onschallenge.wikispaces.com/students | average of 10 | C=CCCCCC |