PubChem CID
MIC H37Rv (µM)
NR IC90 (µM) 7 days
JBG50-1-1, TCMDC143693
JBG94-1-1/ JBG98-1-1
Javier Osende Thesis Compound 62E
JBG25-1-1 / JBG25-2-1
Javier Osende Thesis Compound 62B
JBG26-1-1/ JBG26-2-1
OSTBS83JBG29-3-4/ JBG29-4-1/ JBG29-4-2/FI10-2 Prep3OC(C(Cl)=C1)=C(NC(CN2CCOCC2)=O)C(Cl)=C1ClInChI=1S/C12H13Cl3N2O3/c13-7-5-8(14)12(19)11(10(7)15)16-9(18)6-17-1-3-20-4-2-17/h5,19H,1-4,6H2,(H,16,18)QEDWHPUOGUHTIQ-UHFFFAOYSA-N>1252.01MOUSE0.48<4