| A | B | C | D | E | F | G | H | I | J | K | L | M | N | O | P | Q | R | S | T | U | V | W | X | Y | Z | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
1 | Drug candidate | Type | Molecular formula | PubChem CID | Canonical | Molecular Weight | ||||||||||||||||||||
2 | (+)-7,7-Bis[(5R,7R,9R,10S)-2-Oxocadinan-3,6(11)-Dien-12,7-Olide] | Potential inhibitor of SARS-CoV-2 protein targets | C30H34O6 | 25016667 | CC1CC2(C(=C(C(=O)O2)C)C3C1CC(=O)C(=C3)C)C45CC(C6CC(=O)C(=CC6C4=C(C(=O)O5)C)C)C | 490.6 | ||||||||||||||||||||
3 | (+)-Oxoturkiyenine | Potential inhibitor of SARS-CoV-2 protein targets | C20H13NO7 | 189308 | CN1C=CC2=CC3=C(C=C2C(=O)C14C5=C(C6=C(C=C5)OCO6)OC4=O)OCO3 | 379.3 | ||||||||||||||||||||
4 | (2S)-Eriodictyol-7-O-(6"-O-galloyl)-beta-D-glucopyranoside | Potential inhibitor of SARS-CoV-2 protein targets | C28H26O15 | 10930068 | C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C(C(C(O3)COC(=O)C4=CC(=C(C(=C4)O)O)O)O)O)O)C5=CC(=C(C=C5)O)O | 602.5 | ||||||||||||||||||||
5 | 1,3,4,6-tetra-O-galloyl-β-d-glucose | The in vitro activity of 1,3,4,6-tetra-O-galloyl-β-d-glucose against herpes simplex virus has been examined | C34H28O22 | 471531 | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O | 788.6 | ||||||||||||||||||||
6 | 18-Hydroxy-3-epi-alpha-yohimbine | Potential inhibitor of SARS-CoV-2 protein targets | C21H26N2O4 | 102004710 | COC(=O)C1C2CC3C4=C(CCN3CC2CC(C1O)O)C5=CC=CC=C5N4 | 370.4 | ||||||||||||||||||||
7 | 2-(3,4-dihydroxyphenyl)-2-[[2-(3,4-dihydroxyphenyl)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-3-yl]oxy]-3,4-dihydro-2H-1-benzopyran-3,4,5,7-tetrol) - Procyanidin | Potential inhibitor of SARS-CoV-2 protein targets | C30H26O13 | 107876 | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)OC4(C(C(C5=C(C=C(C=C5O4)O)O)O)O)C6=CC(=C(C=C6)O)O | 594.5 | ||||||||||||||||||||
8 | 2-Hydroxy-3-methoxystrychnine | Potential inhibitor of SARS-CoV-2 protein targets | C22H24N2O4 | 21680050 | COC1=C(C=C2C(=C1)N3C4C25CCN6C5CC7C4C(CC3=O)OCC=C7C6)O | 380.4 | ||||||||||||||||||||
9 | 3,5,7,3',4',5'-hexahydroxyflavanone-3-O-beta-D-glucopyranoside | Potential inhibitor of SARS-CoV-2 protein targets | C20H19NO11 | NPACT00105 | c1c(cc(c2c1O[C@@H]([C@H](C2=O)ON[C@@H](CCC(=O)O)C=O)c1cc(c(c(c1)O)O)O)O)O | 449.4 | ||||||||||||||||||||
10 | 3Alpha,17Alpha-Cinchophylline | Potential inhibitor of SARS-CoV-2 protein targets | C30H34N4O | 76326662 | COC1=CC=CC2=C1C3=C(N2)C(NCC3)CC4CC5C6=C(CCN5CC4C=C)C7=CC=CC=C7N6 | 466.6 | ||||||||||||||||||||
11 | 4-(3,4-Dihydroxyphenyl)-7-methoxy-5-[(6-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-2H-1-benzopyran-2-one | Potential inhibitor of SARS-CoV-2 protein targets | C27H30O15 | 117065340 | COC1=CC2=C(C(=CC(=O)O2)C3=CC(=C(C=C3)O)O)C(=C1)OC4C(C(C(C(O4)COC5C(C(C(CO5)O)O)O)O)O)O | 594.5 | ||||||||||||||||||||
12 | 4-hydroxyisolonchocarpin | Potential inhibitor of SARS-CoV-2 protein targets | C20H18O4 | 5321800 | CC1(C=CC2=CC(=C(C=C2O1)O)C(=O)C=CC3=CC=C(C=C3)O)C | 322.4 | ||||||||||||||||||||
13 | 4'-O-methylbavachalcone | Potential inhibitor of SARS-CoV-2 protein targets | C22H24O4 | 42607530 | CC(=CCC1=CC(=C(C=C1OC)O)C(=O)C=CC2=CC=C(C=C2)OC)C | 352.4 | ||||||||||||||||||||
14 | 5,7,3',4'-Tetrahydroxy-2'-(3,3-dimethylallyl)isoflavone | Potential inhibitor of SARS-CoV-2 protein targets | C20H18O6 | 11610052 | CC(=CCC1=C(C=CC(=C1O)O)C2=COC3=CC(=CC(=C3C2=O)O)O)C | 354.4 | ||||||||||||||||||||
15 | 5-amino levulinic acid | A naturally synthesised amino acid that potently inhibited SARS-CoV-2 infection in vitro | C5H9NO3 | 137 | C(CC(=O)O)C(=O)CN | 131.1 | ||||||||||||||||||||
16 | 7-Deacetyl-7-benzoylgedunin | Potential inhibitor of SARS-CoV-2 protein targets | C33H36O7 | 52952112 | CC1(C2CC(C3(C(C2(C=CC1=O)C)CCC4(C35C(O5)C(=O)OC4C6=COC=C6)C)C)OC(=O)C7=CC=CC=C7)C | 544.6 | ||||||||||||||||||||
17 | Acteoside | Potential inhibitor of SARS-CoV-2 protein targets | C29H36O15 | 5281800 | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)CO)OCCC4=CC(=C(C=C4)O)O)O)O)O)O | 624.6 | ||||||||||||||||||||
18 | Adlumidine | Potential inhibitor of SARS-CoV-2 protein targets | C20H17NO6 | 120734 | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 | 367.4 | ||||||||||||||||||||
19 | Alantolactone | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C15H20O2 | 72724 | CC1CCCC2(C1=CC3C(C2)OC(=O)C3=C)C | 232.3 | ||||||||||||||||||||
20 | Allicin | An organosulfur compound that may have immunomodulatory and antiviral effects | C6H10OS2 | 65036 | C=CCSS(=O)CC=C | 162.3 | ||||||||||||||||||||
21 | Alloyohimbine | Potential inhibitor of SARS-CoV-2 protein targets | C21H26N2O3 | 120716 | COC(=O)C1C(CCC2C1CC3C4=C(CCN3C2)C5=CC=CC=C5N4)O | 354.4 | ||||||||||||||||||||
22 | alpha-Colubrine | Potential inhibitor of SARS-CoV-2 protein targets | C22H24N2O3 | 12303796 | COC1=CC2=C(C=C1)C34CCN5C3CC6C7C4N2C(=O)CC7OCC=C6C5 | 364.4 | ||||||||||||||||||||
23 | Amaranthin | Potential inhibitor of SARS-CoV-2 protein targets | C30H34N2O19 | 6123095 | C1C(NC(=CC1=CC=[N+]2C(CC3=CC(=C(C=C32)O)OC4C(C(C(C(O4)CO)O)O)OC5C(C(C(C(O5)C(=O)O)O)O)O)C(=O)[O-])C(=O)O)C(=O)O | 726.6 | ||||||||||||||||||||
24 | Amarogentin | Potential inhibitor of SARS-CoV-2 protein targets | C29H30O13 | 115149 | C=CC1C2CCOC(=O)C2=COC1OC3C(C(C(C(O3)CO)O)O)OC(=O)C4=C(C=C(C=C4O)O)C5=CC(=CC=C5)O | 586.5 | ||||||||||||||||||||
25 | Amentoflavone | Potential inhibitor of SARS-CoV-2 protein targets | C30H18O10 | 5281600 | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=C(C=CC(=C4)C5=CC(=O)C6=C(C=C(C=C6O5)O)O)O)O | 538.5 | ||||||||||||||||||||
26 | Anabsinthin | Potential inhibitor of SARS-CoV-2 protein targets | C30H40O6 | 44558930 | CC1C2CCC(C3C4C5CC6(C7(C4C(=C3C2OC1=O)C)C5C(O6)(CCC8C7OC(=O)C8C)C)C)(C)O | 496.6 | ||||||||||||||||||||
27 | Anaferine | Potential inhibitor of SARS-CoV-2 protein targets | C13H24N2O | 443143 | C1CCNC(C1)CC(=O)CC2CCCCN2 | 224.3 | ||||||||||||||||||||
28 | Andrographolide | Potential inhibitor of SARS-CoV-2 protein targets | C20H30O5 | 5318517 | CC12CCC(C(C1CCC(=C)C2CC=C3C(COC3=O)O)(C)CO)O | 350.4 | ||||||||||||||||||||
29 | Anisotine | Potential inhibitor of SARS-CoV-2 protein targets | C20H19N3O3 | 442884 | CNC1=C(C=C(C=C1)C2CCN3C2=NC4=CC=CC=C4C3=O)C(=O)OC | 349.4 | ||||||||||||||||||||
30 | Anthraquinone | Potential inhibitor of SARS-CoV-2 protein targets | C14H8O2 | 6780 | C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3C2=O | 208.2 | ||||||||||||||||||||
31 | Antroquinonol | Its safety and efficacy in the treatment of mild to moderate pneumonia as a result of COVID-19 is being investigated | C24H38O4 | 24875259 | CC1C(C(C(=C(C1=O)OC)OC)O)CC=C(C)CCC=C(C)CCC=C(C)C | 390.6 | ||||||||||||||||||||
32 | Apigenin | A flavonoid with potential antiviral, antioxidant and anti-inflammatory activity | C15H10O5 | 5280443 | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O | 270.2 | ||||||||||||||||||||
33 | Ararobinol | Potential inhibitor of SARS-CoV-2 protein targets | C30H22O6 | 438692 | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2C4C5=C(C(=CC=C5)O)C(=O)C6=C4C=C(C=C6O)C)C=CC=C3O | 478.5 | ||||||||||||||||||||
34 | Arctigenin | Its therapeutic efficacy against several viruses has been previously investigated | C21H24O6 | 64981 | COC1=C(C=C(C=C1)CC2COC(=O)C2CC3=CC(=C(C=C3)O)OC)OC | 372.4 | ||||||||||||||||||||
35 | Arjunic acid | Potential inhibitor of SARS-CoV-2 protein targets | C30H48O5 | 15385516 | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)C)O)O)C)C)C2C1O)C)C(=O)O)C | 488.7 | ||||||||||||||||||||
36 | Asparagamine A | Potential inhibitor of SARS-CoV-2 protein targets | C22H27NO5 | ChemSpider ID: 10269744 | C[C@H]1/C(O[C@@]23O[C@H]4[C@]5(/C=C/CC)[N@@](CC[C@H]35)[C@H](C4)[C@@H]21)=C6OC(C(C)=C/6OC)=O | 385.5 | ||||||||||||||||||||
37 | Baicalein | An aglycone of baicalin that may have inhibitory activity against SARS-CoV-2 | C15H10O5 | 5281605 | C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C(=C3O)O)O | 270.2 | ||||||||||||||||||||
38 | Baicalin | May have inhibitory activity against SARS-CoV-2 | C21H18O11 | 64982 | C1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)O)O)O | 446.4 | ||||||||||||||||||||
39 | Bavachin | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C20H20O4 | 14236566 | CC(=CCC1=CC2=C(C=C1O)OC(CC2=O)C3=CC=C(C=C3)O)C | 324.4 | ||||||||||||||||||||
40 | Benzquercin | Flavonoid compound that has been screened against the SARS-CoV-2 RNA dependent RNA polymerase | C50H40O7 | 65604 | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C3=C(C(=O)C4=C(O3)C=C(C=C4OCC5=CC=CC=C5)OCC6=CC=CC=C6)OCC7=CC=CC=C7)OCC8=CC=CC=C8 | 752.8 | ||||||||||||||||||||
41 | Berberine | Potential inhibitor of SARS-CoV-2 protein targets | C20H18NO4+ | 2353 | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC | 336.4 | ||||||||||||||||||||
42 | Betulinic acid | May be a potential small molecule inhibitor of SARS-CoV-2 protein targets | C30H48O3 | 64971 | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)O)C)C(=O)O | 456.7 | ||||||||||||||||||||
43 | Biflavone | Potential inhibitor of SARS-CoV-2 protein targets | C30H18O4 | 9980790 | C1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)C4=C(OC5=CC=CC=C5C4=O)C6=CC=CC=C6 | 442.5 | ||||||||||||||||||||
44 | Bisdemethoxycurcumin | A curcuminoid with antioxidant, antiviral and anti-inflammatory properties | C19H16O4 | 5315472 | C1=CC(=CC=C1C=CC(=O)CC(=O)C=CC2=CC=C(C=C2)O)O | 308.3 | ||||||||||||||||||||
45 | Broussochalcone A | Potential inhibitor of SARS-CoV-2 protein targets | C20H20O5 | 6438825 | CC(=CCC1=CC(=C(C=C1O)O)C(=O)C=CC2=CC(=C(C=C2)O)O)C | 340.4 | ||||||||||||||||||||
46 | Bruceine A | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C26H34O11 | 160006 | CC1=C(C(=O)CC2(C1CC3C45C2C(C(C(C4C(C(=O)O3)OC(=O)CC(C)C)(OC5)C(=O)OC)O)O)C)O | 522.5 | ||||||||||||||||||||
47 | Brusatol | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C26H32O11 | 73432 | CC1=C(C(=O)CC2(C1CC3C45C2C(C(C(C4C(C(=O)O3)OC(=O)C=C(C)C)(OC5)C(=O)OC)O)O)C)O | 520.5 | ||||||||||||||||||||
48 | Bufalin | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C24H34O4 | 9547215 | CC12CCC(CC1CCC3C2CCC4(C3(CCC4C5=COC(=O)C=C5)O)C)O | 386.5 | ||||||||||||||||||||
49 | Bufotaline | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C26H36O6 | 12302120 | CC(=O)OC1CC2(C3CCC4CC(CCC4(C3CCC2(C1C5=COC(=O)C=C5)C)C)O)O | 444.6 | ||||||||||||||||||||
50 | Cadambine | Potential inhibitor of SARS-CoV-2 protein targets | C27H32N2O10 | 21723831 | COC(=O)C1=COC(C2C1CC34C5=C(CCN3CC2O4)C6=CC=CC=C6N5)OC7C(C(C(C(O7)CO)O)O)O | 544.5 | ||||||||||||||||||||
51 | Caffeic acid phenethyl ester - Propolis (from bees) | Antiviral and anti-inflammatory properties - a potential inhibitor of SARS-CoV-2 protein targets | C17H16O4 | 5281787 | C1=CC=C(C=C1)CCOC(=O)C=CC2=CC(=C(C=C2)O)O | 284.3 | ||||||||||||||||||||
52 | Calceolarioside B | Potential inhibitor of SARS-CoV-2 protein targets | C23H26O11 | 5273567 | C1=CC(=C(C=C1CCOC2C(C(C(C(O2)COC(=O)C=CC3=CC(=C(C=C3)O)O)O)O)O)O)O | 478.4 | ||||||||||||||||||||
53 | Calendoflaside | Potential inhibitor of SARS-CoV-2 protein targets | C28H32O15 | 14238620 | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)OC)C)O)O)O)O)O | 608.5 | ||||||||||||||||||||
54 | Camphor | Potential inhibitor of SARS-CoV-2 protein targets | C10H16O | 2537 | CC1(C2CCC1(C(=O)C2)C)C | 152.2 | ||||||||||||||||||||
55 | Camptothecin | Potential inhibitor of SARS-CoV-2 protein targets | C20H16N2O4 | 24360 | CCC1(C2=C(COC1=O)C(=O)N3CC4=CC5=CC=CC=C5N=C4C3=C2)O | 348.4 | ||||||||||||||||||||
56 | Cannabidiol | A compound from Cannabis sativa that has anti-inflammatory properties and could be used for the treatment of COVID-19 | C21H30O2 | 644019 | CCCCCC1=CC(=C(C(=C1)O)C2C=C(CCC2C(=C)C)C)O | 314.5 | ||||||||||||||||||||
57 | Cannabigerol | A compound from Cannabis sativa that has anti-inflammatory properties and could be used for the treatment of COVID-19 | C21H32O2 | 5315659 | CCCCCC1=CC(=C(C(=C1)O)CC=C(C)CCC=C(C)C)O | 316.5 | ||||||||||||||||||||
58 | Carvacrol | Potential inhibitor of SARS-CoV-2 protein targets | C10H14O | 10364 | CC1=C(C=C(C=C1)C(C)C)O | 150.2 | ||||||||||||||||||||
59 | Castalagin | The antiviral properties of castalagin against herpes simplex virus has been investigated | C41H26O26 | 168165 (ChemSpider: 62895210) | C1C2C(C3C4C(C5=C(C(=C(C(=C5C(=O)O4)C6=C(C(=C(C(=C6C(=O)O3)C7=C(C(=C(C=C7C(=O)O2)O)O)O)O)O)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O1)O)O)O)O)O)O | 934.6 | ||||||||||||||||||||
60 | Catechin | Potential inhibitor of SARS-CoV-2 protein targets | C15H14O6 | 9064 | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O | 290.3 | ||||||||||||||||||||
61 | Cepharanthine | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C37H38N2O6 | 10206 | CN1CCC2=CC3=C(C4=C2C1CC5=CC=C(C=C5)OC6=C(C=CC(=C6)CC7C8=CC(=C(C=C8CCN7C)OC)O4)OC)OCO3 | 606.7 | ||||||||||||||||||||
62 | Chebulagic acid | A natural compound that has antiviral activity against SARS-CoV-2, including the main protease | C41H30O27 | 250397 (ChemSpider: 391031) | C1C2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5C(C(C(=O)O3)CC(=O)O)C(C(=O)O6)O)O)O)OC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O1)O)O)O)O)O)O | 954.7 | ||||||||||||||||||||
63 | Cholecalciferol | May reduce the odds of of developing respiratory infections | C27H44O | 5280795 | CC(C)CCCC(C)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C | 384.6 | ||||||||||||||||||||
64 | Chrysin | Antiviral and anti-inflammatory properties - a potential inhibitor of SARS-CoV-2 protein targets | C15H10O4 | 5281607 | C1=CC=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O | 254.2 | ||||||||||||||||||||
65 | Cinobufagin | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C26H34O6 | 11969542 | CC(=O)OC1C(C2(CCC3C(C24C1O4)CCC5C3(CCC(C5)O)C)C)C6=COC(=O)C=C6 | 442.5 | ||||||||||||||||||||
66 | Clemastanin B | A lignan that has activity against viruses, including human and avian influenza viruses | C32H44O16 | 10009802 | COC1=C(C=CC(=C1)CC2COC(C2CO)C3=CC(=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC)OC5C(C(C(C(O5)CO)O)O)O | 684.7 | ||||||||||||||||||||
67 | Colchicine | An alkaloid that has anti-inflammatory activity and may be used as a potential treatment for COVID-19 | C22H25NO6 | 6167 | CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC | 399.4 | ||||||||||||||||||||
68 | Colistin | Potential inhibitor of SARS-CoV-2 protein targets | C52H98N16O13 | 5311054 | CCC(C)CCCC(=O)NC(CCN)C(=O)NC(C(C)O)C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CCN)CC(C)C)CC(C)C)CCN)CCN)C(C)O | 1155.4 | ||||||||||||||||||||
69 | Coniferyl aldehyde | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C10H10O3 | 5280536 | COC1=C(C=CC(=C1)C=CC=O)O | 178.2 | ||||||||||||||||||||
70 | Cordifolioside A | Potential inhibitor of SARS-CoV-2 protein targets | C22H32O13 | 75111036 | COC1=CC(=CC(=C1OC2C(C(C(C(O2)CO)O)OC3C(C(CO3)(CO)O)O)O)OC)C=CCO | 504.5 | ||||||||||||||||||||
71 | Corilagin | A polyphenol that could potentially inhibit SARS-CoV-2 viral entry and replication | C27H22O18 | 73568 | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O)O | 634.5 | ||||||||||||||||||||
72 | Cornuside | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C24H30O14 | 11228694 | COC(=O)C1=COC(C(C1CCOC(=O)C2=CC(=C(C(=C2)O)O)O)C=C)OC3C(C(C(C(O3)CO)O)O)O | 542.5 | ||||||||||||||||||||
73 | Corosolic acid | Potential inhibitor of SARS-CoV-2 protein targets | C30H48O4 | 6918774 | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)C)O)O)C)C)C2C1C)C)C(=O)O | 472.7 | ||||||||||||||||||||
74 | Crocetin | A natural compound that may have antiviral properties | C20H24O4 | 5281232 | CC(=CC=CC=C(C)C=CC=C(C)C(=O)O)C=CC=C(C)C(=O)O | 328.4 | ||||||||||||||||||||
75 | Cryptotanshinone | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C19H20O3 | 160254 | CC1COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C | 296.4 | ||||||||||||||||||||
76 | Curcumin | A natural compound that could be used to modulate the immune response (suppress inflammation) | C21H20O6 | 969516 | COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC(=C(C=C2)O)OC)O | 368.4 | ||||||||||||||||||||
77 | Cyanidin-3-O-glucoside | Potential inhibitor of SARS-CoV-2 protein targets | C21H21O11+ | 4481259 | C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2OC4C(C(C(C(O4)CO)O)O)O)O)O)O)O | 449.4 | ||||||||||||||||||||
78 | Cyclocurcumin | Potential inhibitor of SARS-CoV-2 protein targets | C21H20O6 | 69879809 | COC1=C(C=CC(=C1)C=CC2=CC(=O)CC(O2)C3=CC(=C(C=C3)O)OC)O | 368.4 | ||||||||||||||||||||
79 | Dehydrocostus lactone | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C15H18O2 | 73174 | C=C1CCC2C(C3C1CCC3=C)OC(=O)C2=C | 230.3 | ||||||||||||||||||||
80 | Dehydrodiisoeugenol | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C20H22O4 | 5379033 | CC=CC1=CC2=C(C(=C1)OC)OC(C2C)C3=CC(=C(C=C3)O)OC | 326.4 | ||||||||||||||||||||
81 | Demethoxycurcumin | A curcuminoid with antioxidant, antiviral and anti-inflammatory properties | C20H18O5 | 5469424 | COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC=C(C=C2)O)O | 338.4 | ||||||||||||||||||||
82 | Digoxin | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C41H64O14 | 2724385 | CC1C(C(CC(O1)OC2C(OC(CC2O)OC3C(OC(CC3O)OC4CCC5(C(C4)CCC6C5CC(C7(C6(CCC7C8=CC(=O)OC8)O)C)O)C)C)C)O)O | 780.9 | ||||||||||||||||||||
83 | Edgeworoside C | Potential inhibitor of SARS-CoV-2 protein targets | C24H20O10 | 101835682 | CC1C(C(C(C(O1)OC2=C(C3=C(C=C2)C=CC(=O)O3)C4=C(C=CC5=C4OC(=O)C=C5)O)O)O)O | 468.4 | ||||||||||||||||||||
84 | Egenine | Potential inhibitor of SARS-CoV-2 protein targets | C20H19NO6 | 189685 | CN1CCC2=CC3=C(C=C2C1C4C5=C(C(O4)O)C6=C(C=C5)OCO6)OCO3 | 369.4 | ||||||||||||||||||||
85 | Eicosapentaenoic acid | A free fatty acid that could be used to manage the cytokine storm in COVID-19 | C20H30O2 | 446284 | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)O | 302.5 | ||||||||||||||||||||
86 | Ellagic acid | Potential inhibitor of SARS-CoV-2 protein targets | C14H6O8 | 5281855 | C1=C2C3=C(C(=C1O)O)OC(=O)C4=CC(=C(C(=C43)OC2=O)O)O | 302.2 | ||||||||||||||||||||
87 | Ellipticine | Potential inhibitor of SARS-CoV-2 protein targets | C17H14N2 | 3213 | CC1=C2C=CN=CC2=C(C3=C1NC4=CC=CC=C43)C | 246.3 | ||||||||||||||||||||
88 | Emetine | The ability of emetine to inhibit SARS-CoV-2 in vitro and its pharmacokinetic properties in vivo have been investigated | C29H40N2O4 | 10219 | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC | 480.6 | ||||||||||||||||||||
89 | Emodin | Potential inhibitor of SARS-CoV-2 protein targets | C15H10O5 | 3220 | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3O)O | 270.2 | ||||||||||||||||||||
90 | Epicatechin gallate | Potential inhibitor of SARS-CoV-2 protein targets | C22H18O10 | 107905 | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O | 442.4 | ||||||||||||||||||||
91 | Epigallocatechin | Potential inhibitor of SARS-CoV-2 protein targets | C15H14O7 | 72277 | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)O | 306.3 | ||||||||||||||||||||
92 | Epigallocatechin gallate | Potential inhibitor of SARS-CoV-2 protein targets | C22H18O11 | 65064 | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O | 458.4 | ||||||||||||||||||||
93 | Epsilon-viniferin | Potential inhibitor of SARS-CoV-2 protein targets | C28H22O6 | 5281728 | C1=CC(=CC=C1C=CC2=C3C(C(OC3=CC(=C2)O)C4=CC=C(C=C4)O)C5=CC(=CC(=C5)O)O)O | 454.5 | ||||||||||||||||||||
94 | Euscaphic acid | Potential inhibitor of SARS-CoV-2 protein targets | C30H48O5 | 471426 | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)C)O)O)C)C)C2C1(C)O)C)C(=O)O | 488.7 | ||||||||||||||||||||
95 | Fangchinoline | Displayed antiviral effects against SARS-CoV-2 in a cytopathic effect-based high throughput screening assay | C37H40N2O6 | 73481 | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(O3)C(=C(C=C7CCN6C)OC)O)OC)OC | 608.7 | ||||||||||||||||||||
96 | Fisetin | A bioactive flavonol compound that may be used in the management of COVID-19 | C15H10O6 | 5281614 | C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O | 286.2 | ||||||||||||||||||||
97 | Folic acid | Potential inhibitor of SARS-CoV-2 protein targets | C19H19N7O6 | 135398658 | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N | 441.4 | ||||||||||||||||||||
98 | Friedelin | Potential inhibitor of SARS-CoV-2 protein targets | C30H50O | 91472 | CC1C(=O)CCC2C1(CCC3C2(CCC4(C3(CCC5(C4CC(CC5)(C)C)C)C)C)C)C | 426.7 | ||||||||||||||||||||
99 | Galangin | Antiviral and anti-inflammatory properties - a potential inhibitor of SARS-CoV-2 protein targets | C15H10O5 | 5281616 | C1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O | 270.2 | ||||||||||||||||||||
100 | Gallocatechin gallate | Potential inhibitor of SARS-CoV-2 protein targets | C22H18O11 | 199472 | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O | 458.4 |